C13H20ClN — CID 171230824
(1S)-2-cyclopropyl-1-(4-ethylphenyl)ethanamine;hydrochloride (PubChem CID 171230824) has the molecular formula C13H20ClN and a molecular weight of 225.76 g/mol. Its IUPAC name is (1S)-2-cyclopropyl-1-(4-ethylphenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-2-cyclopropyl-1-(4-ethylphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171230824 |
| Molecular Formula | C13H20ClN |
| Molecular Weight | 225.76 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | (1S)-2-cyclopropyl-1-(4-ethylphenyl)ethanamine;hydrochloride |
| SMILES | CCc1ccc([C@@H](N)CC2CC2)cc1.Cl |
| InChI | InChI=1S/C13H19N.ClH/c1-2-10-5-7-12(8-6-10)13(14)9-11-3-4-11;/h5-8,11,13H,2-4,9,14H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | VSWLWEHGNFMSLF-ZOWNYOTGSA-N |
| XLogP | 3.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |