C12H17FN2 — CID 150062889
1-[4-(aminomethyl)-3-fluorophenyl]-2-cyclopropylethanamine (PubChem CID 150062889) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-[4-(aminomethyl)-3-fluorophenyl]-2-cyclopropylethanamine.
| Compound Name | 1-[4-(aminomethyl)-3-fluorophenyl]-2-cyclopropylethanamine |
|---|---|
| PubChem CID | 150062889 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 1-[4-(aminomethyl)-3-fluorophenyl]-2-cyclopropylethanamine |
| SMILES | NCc1ccc(C(N)CC2CC2)cc1F |
| InChI | InChI=1S/C12H17FN2/c13-11-6-9(3-4-10(11)7-14)12(15)5-8-1-2-8/h3-4,6,8,12H,1-2,5,7,14-15H2 |
| InChIKey | DNQWSVJHBAVVBD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |