C12H15BrO — CID 115803918
1-(5-bromo-2-methylphenyl)-2-cyclopropylethanol (PubChem CID 115803918) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-2-cyclopropylethanol.
| Compound Name | 1-(5-bromo-2-methylphenyl)-2-cyclopropylethanol |
|---|---|
| PubChem CID | 115803918 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-2-cyclopropylethanol |
| SMILES | Cc1ccc(Br)cc1C(O)CC1CC1 |
| InChI | InChI=1S/C12H15BrO/c1-8-2-5-10(13)7-11(8)12(14)6-9-3-4-9/h2,5,7,9,12,14H,3-4,6H2,1H3 |
| InChIKey | RQHIXHMSTUGKFR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |