C17H25BrO — CID 114458586
1-(4-bromo-2,5-dimethylphenyl)-2-cycloheptylethanol (PubChem CID 114458586) has the molecular formula C17H25BrO and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethylphenyl)-2-cycloheptylethanol.
| Compound Name | 1-(4-bromo-2,5-dimethylphenyl)-2-cycloheptylethanol |
|---|---|
| PubChem CID | 114458586 |
| Molecular Formula | C17H25BrO |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(4-bromo-2,5-dimethylphenyl)-2-cycloheptylethanol |
| SMILES | Cc1cc(C(O)CC2CCCCCC2)c(C)cc1Br |
| InChI | InChI=1S/C17H25BrO/c1-12-10-16(18)13(2)9-15(12)17(19)11-14-7-5-3-4-6-8-14/h9-10,14,17,19H,3-8,11H2,1-2H3 |
| InChIKey | DFCRPQMDXYAWDB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |