C15H22O3 — CID 103165429
2-cyclobutyl-1-(4,5-dimethoxy-2-methylphenyl)ethanol (PubChem CID 103165429) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-cyclobutyl-1-(4,5-dimethoxy-2-methylphenyl)ethanol.
| Compound Name | 2-cyclobutyl-1-(4,5-dimethoxy-2-methylphenyl)ethanol |
|---|---|
| PubChem CID | 103165429 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-cyclobutyl-1-(4,5-dimethoxy-2-methylphenyl)ethanol |
| SMILES | COc1cc(C)c(C(O)CC2CCC2)cc1OC |
| InChI | InChI=1S/C15H22O3/c1-10-7-14(17-2)15(18-3)9-12(10)13(16)8-11-5-4-6-11/h7,9,11,13,16H,4-6,8H2,1-3H3 |
| InChIKey | UHGMMDJDKWDAFF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |