C16H19NO — CID 171263780
(1S,2R)-2-amino-1-cyclopropyl-2-(4-methylnaphthalen-1-yl)ethanol (PubChem CID 171263780) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopropyl-2-(4-methylnaphthalen-1-yl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclopropyl-2-(4-methylnaphthalen-1-yl)ethanol |
|---|---|
| PubChem CID | 171263780 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopropyl-2-(4-methylnaphthalen-1-yl)ethanol |
| SMILES | Cc1ccc([C@@H](N)[C@@H](O)C2CC2)c2ccccc12 |
| InChI | InChI=1S/C16H19NO/c1-10-6-9-14(13-5-3-2-4-12(10)13)15(17)16(18)11-7-8-11/h2-6,9,11,15-16,18H,7-8,17H2,1H3/t15-,16+/m1/s1 |
| InChIKey | WHRDSZWJBQZGFT-CVEARBPZSA-N |
| XLogP | 2.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |