C15H17NO2 — CID 171269425
4-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]naphthalen-1-ol (PubChem CID 171269425) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]naphthalen-1-ol.
| Compound Name | 4-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 171269425 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-[(1S,2R)-1-amino-2-cyclopropyl-2-hydroxyethyl]naphthalen-1-ol |
| SMILES | N[C@@H](c1ccc(O)c2ccccc12)[C@H](O)C1CC1 |
| InChI | InChI=1S/C15H17NO2/c16-14(15(18)9-5-6-9)12-7-8-13(17)11-4-2-1-3-10(11)12/h1-4,7-9,14-15,17-18H,5-6,16H2/t14-,15+/m0/s1 |
| InChIKey | JLVBWBRZNVEUGC-LSDHHAIUSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |