C19H19NO2 — CID 171263774
4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]naphthalen-1-ol (PubChem CID 171263774) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]naphthalen-1-ol.
| Compound Name | 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 171263774 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[(1R,2S)-1-amino-2-hydroxy-3-phenylpropyl]naphthalen-1-ol |
| SMILES | N[C@H](c1ccc(O)c2ccccc12)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c20-19(18(22)12-13-6-2-1-3-7-13)16-10-11-17(21)15-9-5-4-8-14(15)16/h1-11,18-19,21-22H,12,20H2/t18-,19+/m0/s1 |
| InChIKey | ICTYTFHFUYFZEW-RBUKOAKNSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |