C19H26N2O2 — CID 171266479
2-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-5-(diethylamino)phenol (PubChem CID 171266479) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-5-(diethylamino)phenol.
| Compound Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-5-(diethylamino)phenol |
|---|---|
| PubChem CID | 171266479 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-[(1S,2R)-1-amino-2-hydroxy-3-phenylpropyl]-5-(diethylamino)phenol |
| SMILES | CCN(CC)c1ccc([C@H](N)[C@H](O)Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C19H26N2O2/c1-3-21(4-2)15-10-11-16(17(22)13-15)19(20)18(23)12-14-8-6-5-7-9-14/h5-11,13,18-19,22-23H,3-4,12,20H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | WAFUMHHGGBLWSQ-MOPGFXCFSA-N |
| XLogP | 2.84 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|