C19H27ClN2O — CID 171263451
(1R,2S)-1-amino-1-[4-(diethylamino)phenyl]-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171263451) has the molecular formula C19H27ClN2O and a molecular weight of 334.89 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-[4-(diethylamino)phenyl]-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-[4-(diethylamino)phenyl]-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263451 |
| Molecular Formula | C19H27ClN2O |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1R,2S)-1-amino-1-[4-(diethylamino)phenyl]-3-phenylpropan-2-ol;hydrochloride |
| SMILES | CCN(CC)c1ccc([C@@H](N)[C@@H](O)Cc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H26N2O.ClH/c1-3-21(4-2)17-12-10-16(11-13-17)19(20)18(22)14-15-8-6-5-7-9-15;/h5-13,18-19,22H,3-4,14,20H2,1-2H3;1H/t18-,19+;/m0./s1 |
| InChIKey | GRMKRJFBPVIFLM-GRTNUQQKSA-N |
| XLogP | 3.56 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|