C15H17ClN2O3 — CID 171260882
(1R,2S)-1-amino-1-(4-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171260882) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(4-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171260882 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | Cl.N[C@H](c1ccc([N+](=O)[O-])cc1)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C15H16N2O3.ClH/c16-15(12-6-8-13(9-7-12)17(19)20)14(18)10-11-4-2-1-3-5-11;/h1-9,14-15,18H,10,16H2;1H/t14-,15+;/m0./s1 |
| InChIKey | PWLXKNOBNWZZTC-LDXVYITESA-N |
| XLogP | 2.62 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|