C16H19ClN2O3 — CID 171263025
(1R,2S)-1-amino-1-(4-methyl-3-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride (PubChem CID 171263025) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-methyl-3-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride.
| Compound Name | (1R,2S)-1-amino-1-(4-methyl-3-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 171263025 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-methyl-3-nitrophenyl)-3-phenylpropan-2-ol;hydrochloride |
| SMILES | Cc1ccc([C@@H](N)[C@@H](O)Cc2ccccc2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H18N2O3.ClH/c1-11-7-8-13(10-14(11)18(20)21)16(17)15(19)9-12-5-3-2-4-6-12;/h2-8,10,15-16,19H,9,17H2,1H3;1H/t15-,16+;/m0./s1 |
| InChIKey | KKBBFZUDQGAGKV-IDVLALEDSA-N |
| XLogP | 2.93 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|