C12H16ClFN2O4 — CID 171248694
ethyl (3S)-3-amino-2-fluoro-3-(4-methyl-3-nitrophenyl)propanoate;hydrochloride (PubChem CID 171248694) has the molecular formula C12H16ClFN2O4 and a molecular weight of 306.72 g/mol. Its IUPAC name is ethyl (3S)-3-amino-2-fluoro-3-(4-methyl-3-nitrophenyl)propanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methyl-3-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171248694 |
| Molecular Formula | C12H16ClFN2O4 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | ethyl (3S)-3-amino-2-fluoro-3-(4-methyl-3-nitrophenyl)propanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(C)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C12H15FN2O4.ClH/c1-3-19-12(16)10(13)11(14)8-5-4-7(2)9(6-8)15(17)18;/h4-6,10-11H,3,14H2,1-2H3;1H/t10?,11-;/m0./s1 |
| InChIKey | KEYRSCBNXBMILD-GQNCZFCYSA-N |
| XLogP | 2.23 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|