C11H14BrClFNO3 — CID 171247823
ethyl (3S)-3-amino-3-(3-bromo-4-hydroxyphenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171247823) has the molecular formula C11H14BrClFNO3 and a molecular weight of 342.59 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-bromo-4-hydroxyphenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-bromo-4-hydroxyphenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171247823 |
| Molecular Formula | C11H14BrClFNO3 |
| Molecular Weight | 342.59 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-bromo-4-hydroxyphenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(O)c(Br)c1.Cl |
| InChI | InChI=1S/C11H13BrFNO3.ClH/c1-2-17-11(16)9(13)10(14)6-3-4-8(15)7(12)5-6;/h3-5,9-10,15H,2,14H2,1H3;1H/t9?,10-;/m0./s1 |
| InChIKey | HFTJGSQMARFLLK-FTCYEJDNSA-N |
| XLogP | 2.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.59 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |