C12H16BrClFNO3 — CID 171248322
ethyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171248322) has the molecular formula C12H16BrClFNO3 and a molecular weight of 356.62 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171248322 |
| Molecular Formula | C12H16BrClFNO3 |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3-bromo-4-methoxyphenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1ccc(OC)c(Br)c1.Cl |
| InChI | InChI=1S/C12H15BrFNO3.ClH/c1-3-18-12(16)10(14)11(15)7-4-5-9(17-2)8(13)6-7;/h4-6,10-11H,3,15H2,1-2H3;1H/t10?,11-;/m0./s1 |
| InChIKey | HZDKXGXTEFQBDL-GQNCZFCYSA-N |
| XLogP | 2.78 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |