C12H14BrFO4 — CID 79366831
ethyl 3-(3-bromo-4-methoxyphenyl)-2-fluoro-3-hydroxypropanoate (PubChem CID 79366831) has the molecular formula C12H14BrFO4 and a molecular weight of 321.14 g/mol. Its IUPAC name is ethyl 3-(3-bromo-4-methoxyphenyl)-2-fluoro-3-hydroxypropanoate.
| Compound Name | ethyl 3-(3-bromo-4-methoxyphenyl)-2-fluoro-3-hydroxypropanoate |
|---|---|
| PubChem CID | 79366831 |
| Molecular Formula | C12H14BrFO4 |
| Molecular Weight | 321.14 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | ethyl 3-(3-bromo-4-methoxyphenyl)-2-fluoro-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(F)C(O)c1ccc(OC)c(Br)c1 |
| InChI | InChI=1S/C12H14BrFO4/c1-3-18-12(16)10(14)11(15)7-4-5-9(17-2)8(13)6-7/h4-6,10-11,15H,3H2,1-2H3 |
| InChIKey | RUGLRIBKUQOPSG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.14 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |