C13H18O6 — CID 74828202
ethyl 3-(3,4-dimethoxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 74828202) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is ethyl 3-(3,4-dimethoxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3,4-dimethoxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 74828202 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | ethyl 3-(3,4-dimethoxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18O6/c1-4-19-13(16)12(15)11(14)8-5-6-9(17-2)10(7-8)18-3/h5-7,11-12,14-15H,4H2,1-3H3 |
| InChIKey | AUQUQEMZLXPRMV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |