C12H15NO6 — CID 171866564
ethyl 3-(3-carbamoyl-4-hydroxyphenyl)-2,3-dihydroxypropanoate (PubChem CID 171866564) has the molecular formula C12H15NO6 and a molecular weight of 269.25 g/mol. Its IUPAC name is ethyl 3-(3-carbamoyl-4-hydroxyphenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-carbamoyl-4-hydroxyphenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866564 |
| Molecular Formula | C12H15NO6 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | ethyl 3-(3-carbamoyl-4-hydroxyphenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C12H15NO6/c1-2-19-12(18)10(16)9(15)6-3-4-8(14)7(5-6)11(13)17/h3-5,9-10,14-16H,2H2,1H3,(H2,13,17) |
| InChIKey | YEJJPHDYDGKBOD-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |