ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate

C14H20O4 — CID 171865944

IUPACethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate
SMILESCCOC(=O)C(O)C(O)c1cccc(C(C)C)c1
InChIInChI=1S/C14H20O4/c1-4-18-14(17)13(16)12(15)11-7-5-6-10(8-11)9(2)3/h5-9,12-13,15-16H,4H2,1-3H3
InChIKeyKBOJOOXRQCAUBQ-UHFFFAOYSA-N
MW252.31 g/mol
LogP1.77
Rot. Bonds5

About ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate

ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate (PubChem CID 171865944) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate.

Molecular Properties

Compound Nameethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate
PubChem CID171865944
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Nameethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate
SMILESCCOC(=O)C(O)C(O)c1cccc(C(C)C)c1
InChIInChI=1S/C14H20O4/c1-4-18-14(17)13(16)12(15)11-7-5-6-10(8-11)9(2)3/h5-9,12-13,15-16H,4H2,1-3H3
InChIKeyKBOJOOXRQCAUBQ-UHFFFAOYSA-N
XLogP1.77
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 51.77
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate?
The IUPAC name of ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate (CID 171865944) is ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate.
What is the SMILES notation for ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate?
The canonical SMILES for ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate is CCOC(=O)C(O)C(O)c1cccc(C(C)C)c1.
What is the InChIKey of ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate?
The InChIKey is KBOJOOXRQCAUBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-4-18-14(17)13(16)12(15)11-7-5-6-10(8-11)9(2)3/h5-9,12-13,15-16H,4H2,1-3H3.
What are the key properties of ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate?
ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate has a molecular weight of 252.31 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxy-3-(3-propan-2-ylphenyl)propanoate is sourced from PubChem (CID 171865944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).