C11H16N2O4 — CID 171858406
5-[1,2-dihydroxy-3-(methylamino)propyl]-2-hydroxybenzamide (PubChem CID 171858406) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-3-(methylamino)propyl]-2-hydroxybenzamide.
| Compound Name | 5-[1,2-dihydroxy-3-(methylamino)propyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 171858406 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 5-[1,2-dihydroxy-3-(methylamino)propyl]-2-hydroxybenzamide |
| SMILES | CNCC(O)C(O)c1ccc(O)c(C(N)=O)c1 |
| InChI | InChI=1S/C11H16N2O4/c1-13-5-9(15)10(16)6-2-3-8(14)7(4-6)11(12)17/h2-4,9-10,13-16H,5H2,1H3,(H2,12,17) |
| InChIKey | NTHFBSUTCLUDPA-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |