methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate

C13H16O7 — CID 171896189

IUPACmethyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate
SMILESCOC(=O)CC(O)C(O)c1ccc(O)c(C(=O)OC)c1
InChIInChI=1S/C13H16O7/c1-19-11(16)6-10(15)12(17)7-3-4-9(14)8(5-7)13(18)20-2/h3-5,10,12,14-15,17H,6H2,1-2H3
InChIKeyGGOXKPJREZPNHP-UHFFFAOYSA-N
MW284.26 g/mol
LogP0.14
Rot. Bonds5

About methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate

methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate (PubChem CID 171896189) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate.

Molecular Properties

Compound Namemethyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate
PubChem CID171896189
Molecular FormulaC13H16O7
Molecular Weight284.26 g/mol
Exact Mass284.09
IUPAC Namemethyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate
SMILESCOC(=O)CC(O)C(O)c1ccc(O)c(C(=O)OC)c1
InChIInChI=1S/C13H16O7/c1-19-11(16)6-10(15)12(17)7-3-4-9(14)8(5-7)13(18)20-2/h3-5,10,12,14-15,17H,6H2,1-2H3
InChIKeyGGOXKPJREZPNHP-UHFFFAOYSA-N
XLogP0.14
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.26
LogP ≤ 50.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Analyze methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate?
The IUPAC name of methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate (CID 171896189) is methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate.
What is the SMILES notation for methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate?
The canonical SMILES for methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate is COC(=O)CC(O)C(O)c1ccc(O)c(C(=O)OC)c1.
What is the InChIKey of methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate?
The InChIKey is GGOXKPJREZPNHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O7/c1-19-11(16)6-10(15)12(17)7-3-4-9(14)8(5-7)13(18)20-2/h3-5,10,12,14-15,17H,6H2,1-2H3.
What are the key properties of methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate?
methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate has a molecular weight of 284.26 g/mol, XLogP of 0.14, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(1,2-dihydroxy-4-methoxy-4-oxobutyl)-2-hydroxybenzoate is sourced from PubChem (CID 171896189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).