C12H13FO5 — CID 171895507
methyl 4-(3-fluoro-4-formylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171895507) has the molecular formula C12H13FO5 and a molecular weight of 256.23 g/mol. Its IUPAC name is methyl 4-(3-fluoro-4-formylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | methyl 4-(3-fluoro-4-formylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171895507 |
| Molecular Formula | C12H13FO5 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | methyl 4-(3-fluoro-4-formylphenyl)-3,4-dihydroxybutanoate |
| SMILES | COC(=O)CC(O)C(O)c1ccc(C=O)c(F)c1 |
| InChI | InChI=1S/C12H13FO5/c1-18-11(16)5-10(15)12(17)7-2-3-8(6-14)9(13)4-7/h2-4,6,10,12,15,17H,5H2,1H3 |
| InChIKey | VCJQYFMZWGTOKQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|