C10H10BrFO3 — CID 171859899
4-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzaldehyde (PubChem CID 171859899) has the molecular formula C10H10BrFO3 and a molecular weight of 277.09 g/mol. Its IUPAC name is 4-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzaldehyde.
| Compound Name | 4-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 171859899 |
| Molecular Formula | C10H10BrFO3 |
| Molecular Weight | 277.09 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 4-(3-bromo-1,2-dihydroxypropyl)-2-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(C(O)C(O)CBr)cc1F |
| InChI | InChI=1S/C10H10BrFO3/c11-4-9(14)10(15)6-1-2-7(5-13)8(12)3-6/h1-3,5,9-10,14-15H,4H2 |
| InChIKey | UCSOZEKRHOFHBD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.09 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|