C11H11BrO4 — CID 171860282
5-(3-bromo-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde (PubChem CID 171860282) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is 5-(3-bromo-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 5-(3-bromo-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 171860282 |
| Molecular Formula | C11H11BrO4 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 5-(3-bromo-1,2-dihydroxypropyl)benzene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)cc(C(O)C(O)CBr)c1 |
| InChI | InChI=1S/C11H11BrO4/c12-4-10(15)11(16)9-2-7(5-13)1-8(3-9)6-14/h1-3,5-6,10-11,15-16H,4H2 |
| InChIKey | BZATUVWRYSQMCU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|