C11H13NO4 — CID 171898794
4-(3-formylphenyl)-3,4-dihydroxybutanamide (PubChem CID 171898794) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 4-(3-formylphenyl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(3-formylphenyl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898794 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-(3-formylphenyl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1cccc(C=O)c1 |
| InChI | InChI=1S/C11H13NO4/c12-10(15)5-9(14)11(16)8-3-1-2-7(4-8)6-13/h1-4,6,9,11,14,16H,5H2,(H2,12,15) |
| InChIKey | KLRIUTXKZRCEAY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|