C12H12O6 — CID 171877975
4-(3,5-diformylphenyl)-3,4-dihydroxybutanoic acid (PubChem CID 171877975) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 4-(3,5-diformylphenyl)-3,4-dihydroxybutanoic acid.
| Compound Name | 4-(3,5-diformylphenyl)-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171877975 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 4-(3,5-diformylphenyl)-3,4-dihydroxybutanoic acid |
| SMILES | O=Cc1cc(C=O)cc(C(O)C(O)CC(=O)O)c1 |
| InChI | InChI=1S/C12H12O6/c13-5-7-1-8(6-14)3-9(2-7)12(18)10(15)4-11(16)17/h1-3,5-6,10,12,15,18H,4H2,(H,16,17) |
| InChIKey | SDHDQIWBGYICEC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|