C11H12F3NO4 — CID 171878329
4-[3-amino-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoic acid (PubChem CID 171878329) has the molecular formula C11H12F3NO4 and a molecular weight of 279.21 g/mol. Its IUPAC name is 4-[3-amino-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoic acid.
| Compound Name | 4-[3-amino-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoic acid |
|---|---|
| PubChem CID | 171878329 |
| Molecular Formula | C11H12F3NO4 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 4-[3-amino-5-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoic acid |
| SMILES | Nc1cc(C(O)C(O)CC(=O)O)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO4/c12-11(13,14)6-1-5(2-7(15)3-6)10(19)8(16)4-9(17)18/h1-3,8,10,16,19H,4,15H2,(H,17,18) |
| InChIKey | NWWGKYGLTFJXPF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|