C18H10F12O2 — CID 101179006
(1R,2R)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethane-1,2-diol (PubChem CID 101179006) has the molecular formula C18H10F12O2 and a molecular weight of 486.25 g/mol. Its IUPAC name is (1R,2R)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethane-1,2-diol |
|---|---|
| PubChem CID | 101179006 |
| Molecular Formula | C18H10F12O2 |
| Molecular Weight | 486.25 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (1R,2R)-1,2-bis[3,5-bis(trifluoromethyl)phenyl]ethane-1,2-diol |
| SMILES | O[C@H](c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H](O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F12O2/c19-15(20,21)9-1-7(2-10(5-9)16(22,23)24)13(31)14(32)8-3-11(17(25,26)27)6-12(4-8)18(28,29)30/h1-6,13-14,31-32H/t13-,14-/m1/s1 |
| InChIKey | OOVJJBVWQJFOFJ-ZIAGYGMSSA-N |
| XLogP | 6.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.25 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |