C13H12F6 — CID 142096836
1-(3-methylbut-3-en-2-yl)-3,5-bis(trifluoromethyl)benzene (PubChem CID 142096836) has the molecular formula C13H12F6 and a molecular weight of 282.23 g/mol. Its IUPAC name is 1-(3-methylbut-3-en-2-yl)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 1-(3-methylbut-3-en-2-yl)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 142096836 |
| Molecular Formula | C13H12F6 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 1-(3-methylbut-3-en-2-yl)-3,5-bis(trifluoromethyl)benzene |
| SMILES | C=C(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F6/c1-7(2)8(3)9-4-10(12(14,15)16)6-11(5-9)13(17,18)19/h4-6,8H,1H2,2-3H3 |
| InChIKey | UWVVGTNCRYUDDR-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|