C13H13F6N — CID 171198597
(1R)-1-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-1-amine (PubChem CID 171198597) has the molecular formula C13H13F6N and a molecular weight of 297.24 g/mol. Its IUPAC name is (1R)-1-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-1-amine.
| Compound Name | (1R)-1-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 171198597 |
| Molecular Formula | C13H13F6N |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (1R)-1-[3,5-bis(trifluoromethyl)phenyl]-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)C[C@@H](N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13F6N/c1-7(2)3-11(20)8-4-9(12(14,15)16)6-10(5-8)13(17,18)19/h4-6,11H,1,3,20H2,2H3/t11-/m1/s1 |
| InChIKey | KDDFXJRDSSUGHK-LLVKDONJSA-N |
| XLogP | 4.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|