C13H19N — CID 131096191
(1R)-1-(3,5-dimethylphenyl)-3-methylbut-3-en-1-amine (PubChem CID 131096191) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1R)-1-(3,5-dimethylphenyl)-3-methylbut-3-en-1-amine.
| Compound Name | (1R)-1-(3,5-dimethylphenyl)-3-methylbut-3-en-1-amine |
|---|---|
| PubChem CID | 131096191 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1R)-1-(3,5-dimethylphenyl)-3-methylbut-3-en-1-amine |
| SMILES | C=C(C)C[C@@H](N)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H19N/c1-9(2)5-13(14)12-7-10(3)6-11(4)8-12/h6-8,13H,1,5,14H2,2-4H3/t13-/m1/s1 |
| InChIKey | UHABQGFGEKDJOJ-CYBMUJFWSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|