C10H15NO — CID 60756661
2-amino-2-(3,5-dimethylphenyl)ethanol (PubChem CID 60756661) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-amino-2-(3,5-dimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 60756661 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 2-amino-2-(3,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(C)cc(C(N)CO)c1 |
| InChI | InChI=1S/C10H15NO/c1-7-3-8(2)5-9(4-7)10(11)6-12/h3-5,10,12H,6,11H2,1-2H3 |
| InChIKey | WZFVOURVLDLEGP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |