C8H9F2NO — CID 55278901
(2S)-2-amino-2-(3,5-difluorophenyl)ethanol (PubChem CID 55278901) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is (2S)-2-amino-2-(3,5-difluorophenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(3,5-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 55278901 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | (2S)-2-amino-2-(3,5-difluorophenyl)ethanol |
| SMILES | N[C@H](CO)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C8H9F2NO/c9-6-1-5(8(11)4-12)2-7(10)3-6/h1-3,8,12H,4,11H2/t8-/m1/s1 |
| InChIKey | ROJBFFNJZLJBJI-MRVPVSSYSA-N |
| XLogP | 0.96 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |