C8H9I2NO — CID 130000796
2-amino-2-(3,5-diiodophenyl)ethanol (PubChem CID 130000796) has the molecular formula C8H9I2NO and a molecular weight of 388.97 g/mol. Its IUPAC name is 2-amino-2-(3,5-diiodophenyl)ethanol.
| Compound Name | 2-amino-2-(3,5-diiodophenyl)ethanol |
|---|---|
| PubChem CID | 130000796 |
| Molecular Formula | C8H9I2NO |
| Molecular Weight | 388.97 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 2-amino-2-(3,5-diiodophenyl)ethanol |
| SMILES | NC(CO)c1cc(I)cc(I)c1 |
| InChI | InChI=1S/C8H9I2NO/c9-6-1-5(8(11)4-12)2-7(10)3-6/h1-3,8,12H,4,11H2 |
| InChIKey | NBHADDYICCQTGC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.97 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|