C8H8F2INO — CID 66515682
(2R)-2-amino-2-(2,6-difluoro-4-iodophenyl)ethanol (PubChem CID 66515682) has the molecular formula C8H8F2INO and a molecular weight of 299.06 g/mol. Its IUPAC name is (2R)-2-amino-2-(2,6-difluoro-4-iodophenyl)ethanol.
| Compound Name | (2R)-2-amino-2-(2,6-difluoro-4-iodophenyl)ethanol |
|---|---|
| PubChem CID | 66515682 |
| Molecular Formula | C8H8F2INO |
| Molecular Weight | 299.06 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | (2R)-2-amino-2-(2,6-difluoro-4-iodophenyl)ethanol |
| SMILES | N[C@@H](CO)c1c(F)cc(I)cc1F |
| InChI | InChI=1S/C8H8F2INO/c9-5-1-4(11)2-6(10)8(5)7(12)3-13/h1-2,7,13H,3,12H2/t7-/m0/s1 |
| InChIKey | DYJQEFYWQBKBQN-ZETCQYMHSA-N |
| XLogP | 1.56 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.06 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|