C8H9F3N2O — CID 66514091
(2S)-2-amino-2-(2-amino-3,5,6-trifluorophenyl)ethanol (PubChem CID 66514091) has the molecular formula C8H9F3N2O and a molecular weight of 206.17 g/mol. Its IUPAC name is (2S)-2-amino-2-(2-amino-3,5,6-trifluorophenyl)ethanol.
| Compound Name | (2S)-2-amino-2-(2-amino-3,5,6-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 66514091 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | (2S)-2-amino-2-(2-amino-3,5,6-trifluorophenyl)ethanol |
| SMILES | Nc1c(F)cc(F)c(F)c1[C@H](N)CO |
| InChI | InChI=1S/C8H9F3N2O/c9-3-1-4(10)8(13)6(7(3)11)5(12)2-14/h1,5,14H,2,12-13H2/t5-/m1/s1 |
| InChIKey | XPKWQQKOCGRCNG-RXMQYKEDSA-N |
| XLogP | 0.68 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|