C8H7ClF5NO — CID 171210325
(2S)-2-amino-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride (PubChem CID 171210325) has the molecular formula C8H7ClF5NO and a molecular weight of 263.59 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride.
| Compound Name | (2S)-2-amino-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 171210325 |
| Molecular Formula | C8H7ClF5NO |
| Molecular Weight | 263.59 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | (2S)-2-amino-2-(2,3,4,5,6-pentafluorophenyl)ethanol;hydrochloride |
| SMILES | Cl.N[C@H](CO)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H6F5NO.ClH/c9-4-3(2(14)1-15)5(10)7(12)8(13)6(4)11;/h2,15H,1,14H2;1H/t2-;/m1./s1 |
| InChIKey | XJPISOKRBZDBNB-HSHFZTNMSA-N |
| XLogP | 1.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.59 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|