C9H7F6N — CID 131454154
(1S)-3-fluoro-1-(2,3,4,5,6-pentafluorophenyl)propan-1-amine (PubChem CID 131454154) has the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. Its IUPAC name is (1S)-3-fluoro-1-(2,3,4,5,6-pentafluorophenyl)propan-1-amine.
| Compound Name | (1S)-3-fluoro-1-(2,3,4,5,6-pentafluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 131454154 |
| Molecular Formula | C9H7F6N |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | (1S)-3-fluoro-1-(2,3,4,5,6-pentafluorophenyl)propan-1-amine |
| SMILES | N[C@@H](CCF)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7F6N/c10-2-1-3(16)4-5(11)7(13)9(15)8(14)6(4)12/h3H,1-2,16H2/t3-/m0/s1 |
| InChIKey | GEDBWAJBQUDXCL-VKHMYHEASA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|