C9H10ClF4N — CID 171225366
(1S)-3-fluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride (PubChem CID 171225366) has the molecular formula C9H10ClF4N and a molecular weight of 243.63 g/mol. Its IUPAC name is (1S)-3-fluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride.
| Compound Name | (1S)-3-fluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171225366 |
| Molecular Formula | C9H10ClF4N |
| Molecular Weight | 243.63 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | (1S)-3-fluoro-1-(2,3,4-trifluorophenyl)propan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](CCF)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C9H9F4N.ClH/c10-4-3-7(14)5-1-2-6(11)9(13)8(5)12;/h1-2,7H,3-4,14H2;1H/t7-;/m0./s1 |
| InChIKey | RPLXWFLDRAYISO-FJXQXJEOSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.63 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|