C8H10F2N2O — CID 66514003
(2R)-2-amino-2-(4-amino-2,6-difluorophenyl)ethanol (PubChem CID 66514003) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is (2R)-2-amino-2-(4-amino-2,6-difluorophenyl)ethanol.
| Compound Name | (2R)-2-amino-2-(4-amino-2,6-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 66514003 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (2R)-2-amino-2-(4-amino-2,6-difluorophenyl)ethanol |
| SMILES | Nc1cc(F)c([C@@H](N)CO)c(F)c1 |
| InChI | InChI=1S/C8H10F2N2O/c9-5-1-4(11)2-6(10)8(5)7(12)3-13/h1-2,7,13H,3,11-12H2/t7-/m0/s1 |
| InChIKey | HZZIDUNEVJGWQK-ZETCQYMHSA-N |
| XLogP | 0.54 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|