C11H11ClF5N — CID 171210318
(1R)-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-en-1-amine;hydrochloride (PubChem CID 171210318) has the molecular formula C11H11ClF5N and a molecular weight of 287.66 g/mol. Its IUPAC name is (1R)-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171210318 |
| Molecular Formula | C11H11ClF5N |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (1R)-3-methyl-1-(2,3,4,5,6-pentafluorophenyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1c(F)c(F)c(F)c(F)c1F.Cl |
| InChI | InChI=1S/C11H10F5N.ClH/c1-4(2)3-5(17)6-7(12)9(14)11(16)10(15)8(6)13;/h5H,1,3,17H2,2H3;1H/t5-;/m1./s1 |
| InChIKey | JEMIGARKAQYNRA-NUBCRITNSA-N |
| XLogP | 3.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|