C11H13ClF3N — CID 171204902
(1R)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-en-1-amine;hydrochloride (PubChem CID 171204902) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is (1R)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204902 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | (1R)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1c(F)cc(F)cc1F.Cl |
| InChI | InChI=1S/C11H12F3N.ClH/c1-6(2)3-10(15)11-8(13)4-7(12)5-9(11)14;/h4-5,10H,1,3,15H2,2H3;1H/t10-;/m1./s1 |
| InChIKey | NGFJYKQXXCSHCO-HNCPQSOCSA-N |
| XLogP | 3.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|