C15H21Cl2F3N2 — CID 171277543
1-[(1S)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;dihydrochloride (PubChem CID 171277543) has the molecular formula C15H21Cl2F3N2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171277543 |
| Molecular Formula | C15H21Cl2F3N2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[(1S)-3-methyl-1-(2,4,6-trifluorophenyl)but-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@@H](c1c(F)cc(F)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H19F3N2.2ClH/c1-10(2)7-14(20-5-3-19-4-6-20)15-12(17)8-11(16)9-13(15)18;;/h8-9,14,19H,1,3-7H2,2H3;2*1H/t14-;;/m0../s1 |
| InChIKey | JKCUVAKCAAUHRL-UTLKBRERSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|