C13H18ClF3N2 — CID 171169950
1-[(1R)-1-(2,4,6-trifluorophenyl)propyl]piperazine;hydrochloride (PubChem CID 171169950) has the molecular formula C13H18ClF3N2 and a molecular weight of 294.75 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4,6-trifluorophenyl)propyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(2,4,6-trifluorophenyl)propyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171169950 |
| Molecular Formula | C13H18ClF3N2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-[(1R)-1-(2,4,6-trifluorophenyl)propyl]piperazine;hydrochloride |
| SMILES | CC[C@H](c1c(F)cc(F)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C13H17F3N2.ClH/c1-2-12(18-5-3-17-4-6-18)13-10(15)7-9(14)8-11(13)16;/h7-8,12,17H,2-6H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | UEIKJEQPLCXFRS-UTONKHPSSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |