C15H23Cl2F3N2 — CID 171305299
1-[(1S)-2-methyl-1-(2,4,6-trifluorophenyl)butyl]piperazine;dihydrochloride (PubChem CID 171305299) has the molecular formula C15H23Cl2F3N2 and a molecular weight of 359.26 g/mol. Its IUPAC name is 1-[(1S)-2-methyl-1-(2,4,6-trifluorophenyl)butyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-2-methyl-1-(2,4,6-trifluorophenyl)butyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305299 |
| Molecular Formula | C15H23Cl2F3N2 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-[(1S)-2-methyl-1-(2,4,6-trifluorophenyl)butyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1c(F)cc(F)cc1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H21F3N2.2ClH/c1-3-10(2)15(20-6-4-19-5-7-20)14-12(17)8-11(16)9-13(14)18;;/h8-10,15,19H,3-7H2,1-2H3;2*1H/t10?,15-;;/m0../s1 |
| InChIKey | FPXCPTRVKBGWNX-KNLXBKFMSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |