C15H21F3N2 — CID 171305310
1-[(1S)-2-methyl-1-(2,3,5-trifluorophenyl)butyl]piperazine (PubChem CID 171305310) has the molecular formula C15H21F3N2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-[(1S)-2-methyl-1-(2,3,5-trifluorophenyl)butyl]piperazine.
| Compound Name | 1-[(1S)-2-methyl-1-(2,3,5-trifluorophenyl)butyl]piperazine |
|---|---|
| PubChem CID | 171305310 |
| Molecular Formula | C15H21F3N2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-[(1S)-2-methyl-1-(2,3,5-trifluorophenyl)butyl]piperazine |
| SMILES | CCC(C)[C@@H](c1cc(F)cc(F)c1F)N1CCNCC1 |
| InChI | InChI=1S/C15H21F3N2/c1-3-10(2)15(20-6-4-19-5-7-20)12-8-11(16)9-13(17)14(12)18/h8-10,15,19H,3-7H2,1-2H3/t10?,15-/m0/s1 |
| InChIKey | PATPXKJQIIITMT-WRXSAAJRSA-N |
| XLogP | 3.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|