C15H21Cl3F2N2 — CID 171292480
1-[(1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride (PubChem CID 171292480) has the molecular formula C15H21Cl3F2N2 and a molecular weight of 373.70 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292480 |
| Molecular Formula | C15H21Cl3F2N2 |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-[(1R)-1-(3-chloro-2,6-difluorophenyl)-3-methylbut-3-enyl]piperazine;dihydrochloride |
| SMILES | C=C(C)C[C@H](c1c(F)ccc(Cl)c1F)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C15H19ClF2N2.2ClH/c1-10(2)9-13(20-7-5-19-6-8-20)14-12(17)4-3-11(16)15(14)18;;/h3-4,13,19H,1,5-9H2,2H3;2*1H/t13-;;/m1../s1 |
| InChIKey | OMENSJATFFHMRX-FFXKMJQXSA-N |
| XLogP | 4.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|