C11H14ClF2NO — CID 171256557
2-[(1R)-1-amino-3-methylbut-3-enyl]-3,5-difluorophenol;hydrochloride (PubChem CID 171256557) has the molecular formula C11H14ClF2NO and a molecular weight of 249.69 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-methylbut-3-enyl]-3,5-difluorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-methylbut-3-enyl]-3,5-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171256557 |
| Molecular Formula | C11H14ClF2NO |
| Molecular Weight | 249.69 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-[(1R)-1-amino-3-methylbut-3-enyl]-3,5-difluorophenol;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1c(O)cc(F)cc1F.Cl |
| InChI | InChI=1S/C11H13F2NO.ClH/c1-6(2)3-9(14)11-8(13)4-7(12)5-10(11)15;/h4-5,9,15H,1,3,14H2,2H3;1H/t9-;/m1./s1 |
| InChIKey | SVOINEFSYARNOA-SBSPUUFOSA-N |
| XLogP | 3.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|