C9H12ClF2NO2 — CID 171256534
2-[(1R)-1-amino-3-hydroxypropyl]-3,5-difluorophenol;hydrochloride (PubChem CID 171256534) has the molecular formula C9H12ClF2NO2 and a molecular weight of 239.65 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-hydroxypropyl]-3,5-difluorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-hydroxypropyl]-3,5-difluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171256534 |
| Molecular Formula | C9H12ClF2NO2 |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 2-[(1R)-1-amino-3-hydroxypropyl]-3,5-difluorophenol;hydrochloride |
| SMILES | Cl.N[C@H](CCO)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C9H11F2NO2.ClH/c10-5-3-6(11)9(8(14)4-5)7(12)1-2-13;/h3-4,7,13-14H,1-2,12H2;1H/t7-;/m1./s1 |
| InChIKey | DZDQZPPWPMAUEC-OGFXRTJISA-N |
| XLogP | 1.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|