C9H8F2N2O — CID 55273671
(3R)-3-amino-3-(2,4-difluoro-6-hydroxyphenyl)propanenitrile (PubChem CID 55273671) has the molecular formula C9H8F2N2O and a molecular weight of 198.17 g/mol. Its IUPAC name is (3R)-3-amino-3-(2,4-difluoro-6-hydroxyphenyl)propanenitrile.
| Compound Name | (3R)-3-amino-3-(2,4-difluoro-6-hydroxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 55273671 |
| Molecular Formula | C9H8F2N2O |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | (3R)-3-amino-3-(2,4-difluoro-6-hydroxyphenyl)propanenitrile |
| SMILES | N#CC[C@@H](N)c1c(O)cc(F)cc1F |
| InChI | InChI=1S/C9H8F2N2O/c10-5-3-6(11)9(8(14)4-5)7(13)1-2-12/h3-4,7,14H,1,13H2/t7-/m1/s1 |
| InChIKey | CYXAQQFHICWJLW-SSDOTTSWSA-N |
| XLogP | 1.58 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|